C30H40FN3O2 — CID 67157572
1-[3-fluoro-4-[3-(3-phenylpiperidin-1-yl)propoxy]phenyl]-5-(piperidin-1-ylmethyl)pyrrolidin-2-one (PubChem CID 67157572) has the molecular formula C30H40FN3O2 and a molecular weight of 493.67 g/mol. Its IUPAC name is 1-[3-fluoro-4-[3-(3-phenylpiperidin-1-yl)propoxy]phenyl]-5-(piperidin-1-ylmethyl)pyrrolidin-2-one.
| Compound Name | 1-[3-fluoro-4-[3-(3-phenylpiperidin-1-yl)propoxy]phenyl]-5-(piperidin-1-ylmethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 67157572 |
| Molecular Formula | C30H40FN3O2 |
| Molecular Weight | 493.67 g/mol |
| Exact Mass | 493.31 |
| IUPAC Name | 1-[3-fluoro-4-[3-(3-phenylpiperidin-1-yl)propoxy]phenyl]-5-(piperidin-1-ylmethyl)pyrrolidin-2-one |
| SMILES | O=C1CCC(CN2CCCCC2)N1c1ccc(OCCCN2CCCC(c3ccccc3)C2)c(F)c1 |
| InChI | InChI=1S/C30H40FN3O2/c31-28-21-26(34-27(13-15-30(34)35)23-33-16-5-2-6-17-33)12-14-29(28)36-20-8-19-32-18-7-11-25(22-32)24-9-3-1-4-10-24/h1,3-4,9-10,12,14,21,25,27H,2,5-8,11,13,15-20,22-23H2 |
| InChIKey | BWQFWPYHWHKBFY-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.67 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|