C10H15N5 — CID 67159569
2-(1,4-diazabicyclo[3.2.1]octan-4-yl)pyrimidin-5-amine (PubChem CID 67159569) has the molecular formula C10H15N5 and a molecular weight of 205.26 g/mol. Its IUPAC name is 2-(1,4-diazabicyclo[3.2.1]octan-4-yl)pyrimidin-5-amine.
| Compound Name | 2-(1,4-diazabicyclo[3.2.1]octan-4-yl)pyrimidin-5-amine |
|---|---|
| PubChem CID | 67159569 |
| Molecular Formula | C10H15N5 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | 2-(1,4-diazabicyclo[3.2.1]octan-4-yl)pyrimidin-5-amine |
| SMILES | Nc1cnc(N2CCN3CCC2C3)nc1 |
| InChI | InChI=1S/C10H15N5/c11-8-5-12-10(13-6-8)15-4-3-14-2-1-9(15)7-14/h5-6,9H,1-4,7,11H2 |
| InChIKey | YROTVXGRRDEAPZ-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |