C31H33F5N2O3 — CID 67159984
[1-[1-[(E)-3-(3,5-difluorophenyl)prop-2-enoyl]piperidin-4-yl]-2-spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylethyl] 2,2,2-trifluoroacetate (PubChem CID 67159984) has the molecular formula C31H33F5N2O3 and a molecular weight of 576.61 g/mol. Its IUPAC name is [1-[1-[(E)-3-(3,5-difluorophenyl)prop-2-enoyl]piperidin-4-yl]-2-spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylethyl] 2,2,2-trifluoroacetate.
| Compound Name | [1-[1-[(E)-3-(3,5-difluorophenyl)prop-2-enoyl]piperidin-4-yl]-2-spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylethyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 67159984 |
| Molecular Formula | C31H33F5N2O3 |
| Molecular Weight | 576.61 g/mol |
| Exact Mass | 576.24 |
| IUPAC Name | [1-[1-[(E)-3-(3,5-difluorophenyl)prop-2-enoyl]piperidin-4-yl]-2-spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylethyl] 2,2,2-trifluoroacetate |
| SMILES | O=C(/C=C/c1cc(F)cc(F)c1)N1CCC(C(CN2CCC3(CCc4ccccc43)CC2)OC(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C31H33F5N2O3/c32-24-17-21(18-25(33)19-24)5-6-28(39)38-13-8-23(9-14-38)27(41-29(40)31(34,35)36)20-37-15-11-30(12-16-37)10-7-22-3-1-2-4-26(22)30/h1-6,17-19,23,27H,7-16,20H2/b6-5+ |
| InChIKey | ABBOGVICLTZOQE-AATRIKPKSA-N |
| XLogP | 5.67 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.61 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|