C28H35F2N3O — CID 172734214
(E)-3-(3,5-difluorophenyl)-1-[4-[3-(4-methyl-4-phenylpiperidin-1-yl)propyl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 172734214) has the molecular formula C28H35F2N3O and a molecular weight of 467.60 g/mol. Its IUPAC name is (E)-3-(3,5-difluorophenyl)-1-[4-[3-(4-methyl-4-phenylpiperidin-1-yl)propyl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(3,5-difluorophenyl)-1-[4-[3-(4-methyl-4-phenylpiperidin-1-yl)propyl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 172734214 |
| Molecular Formula | C28H35F2N3O |
| Molecular Weight | 467.60 g/mol |
| Exact Mass | 467.27 |
| IUPAC Name | (E)-3-(3,5-difluorophenyl)-1-[4-[3-(4-methyl-4-phenylpiperidin-1-yl)propyl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | CC1(c2ccccc2)CCN(CCCN2CCN(C(=O)/C=C/c3cc(F)cc(F)c3)CC2)CC1 |
| InChI | InChI=1S/C28H35F2N3O/c1-28(24-6-3-2-4-7-24)10-14-31(15-11-28)12-5-13-32-16-18-33(19-17-32)27(34)9-8-23-20-25(29)22-26(30)21-23/h2-4,6-9,20-22H,5,10-19H2,1H3/b9-8+ |
| InChIKey | IFBAOIIJZATYOY-CMDGGOBGSA-N |
| XLogP | 4.57 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.60 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|