C15H19N3OS — CID 671603
2-(morpholin-4-ylmethylideneamino)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carbonitrile (PubChem CID 671603) has the molecular formula C15H19N3OS and a molecular weight of 289.40 g/mol. Its IUPAC name is 2-(morpholin-4-ylmethylideneamino)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carbonitrile.
| Compound Name | 2-(morpholin-4-ylmethylideneamino)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carbonitrile |
|---|---|
| PubChem CID | 671603 |
| Molecular Formula | C15H19N3OS |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 2-(morpholin-4-ylmethylideneamino)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carbonitrile |
| SMILES | N#Cc1c(N=CN2CCOCC2)sc2c1CCCCC2 |
| InChI | InChI=1S/C15H19N3OS/c16-10-13-12-4-2-1-3-5-14(12)20-15(13)17-11-18-6-8-19-9-7-18/h11H,1-9H2 |
| InChIKey | XCFKEYDXZQLRIS-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 48.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|