C25H26ClF3N2O5 — CID 67160703
[2-[2-[3-(5-chlorospiro[3H-1-benzofuran-2,4'-piperidine]-1'-yl)propoxy]anilino]-2-oxoethyl] 2,2,2-trifluoroacetate (PubChem CID 67160703) has the molecular formula C25H26ClF3N2O5 and a molecular weight of 526.94 g/mol. Its IUPAC name is [2-[2-[3-(5-chlorospiro[3H-1-benzofuran-2,4'-piperidine]-1'-yl)propoxy]anilino]-2-oxoethyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-[2-[3-(5-chlorospiro[3H-1-benzofuran-2,4'-piperidine]-1'-yl)propoxy]anilino]-2-oxoethyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 67160703 |
| Molecular Formula | C25H26ClF3N2O5 |
| Molecular Weight | 526.94 g/mol |
| Exact Mass | 526.15 |
| IUPAC Name | [2-[2-[3-(5-chlorospiro[3H-1-benzofuran-2,4'-piperidine]-1'-yl)propoxy]anilino]-2-oxoethyl] 2,2,2-trifluoroacetate |
| SMILES | O=C(COC(=O)C(F)(F)F)Nc1ccccc1OCCCN1CCC2(CC1)Cc1cc(Cl)ccc1O2 |
| InChI | InChI=1S/C25H26ClF3N2O5/c26-18-6-7-20-17(14-18)15-24(36-20)8-11-31(12-9-24)10-3-13-34-21-5-2-1-4-19(21)30-22(32)16-35-23(33)25(27,28)29/h1-2,4-7,14H,3,8-13,15-16H2,(H,30,32) |
| InChIKey | REIVJGAEZJFCGP-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.94 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|