C23H28N2O4 — CID 143746715
4-hydroxy-N-methyl-2-(3-spiro[3H-1-benzofuran-2,4'-piperidine]-1'-ylpropoxy)benzamide (PubChem CID 143746715) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is 4-hydroxy-N-methyl-2-(3-spiro[3H-1-benzofuran-2,4'-piperidine]-1'-ylpropoxy)benzamide.
| Compound Name | 4-hydroxy-N-methyl-2-(3-spiro[3H-1-benzofuran-2,4'-piperidine]-1'-ylpropoxy)benzamide |
|---|---|
| PubChem CID | 143746715 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 4-hydroxy-N-methyl-2-(3-spiro[3H-1-benzofuran-2,4'-piperidine]-1'-ylpropoxy)benzamide |
| SMILES | CNC(=O)c1ccc(O)cc1OCCCN1CCC2(CC1)Cc1ccccc1O2 |
| InChI | InChI=1S/C23H28N2O4/c1-24-22(27)19-8-7-18(26)15-21(19)28-14-4-11-25-12-9-23(10-13-25)16-17-5-2-3-6-20(17)29-23/h2-3,5-8,15,26H,4,9-14,16H2,1H3,(H,24,27) |
| InChIKey | RNGJMCZCXIBNGI-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|