C26H31ClN2O5S — CID 69148937
[2-[(2S)-3-[(2S)-2'-chlorospiro[3H-1-benzofuran-2,4'-piperidine]-1'-yl]-2-hydroxypropoxy]-4-hydroxyphenyl]-thiomorpholin-4-ylmethanone (PubChem CID 69148937) has the molecular formula C26H31ClN2O5S and a molecular weight of 519.06 g/mol. Its IUPAC name is [2-[(2S)-3-[(2S)-2'-chlorospiro[3H-1-benzofuran-2,4'-piperidine]-1'-yl]-2-hydroxypropoxy]-4-hydroxyphenyl]-thiomorpholin-4-ylmethanone.
| Compound Name | [2-[(2S)-3-[(2S)-2'-chlorospiro[3H-1-benzofuran-2,4'-piperidine]-1'-yl]-2-hydroxypropoxy]-4-hydroxyphenyl]-thiomorpholin-4-ylmethanone |
|---|---|
| PubChem CID | 69148937 |
| Molecular Formula | C26H31ClN2O5S |
| Molecular Weight | 519.06 g/mol |
| Exact Mass | 518.16 |
| IUPAC Name | [2-[(2S)-3-[(2S)-2'-chlorospiro[3H-1-benzofuran-2,4'-piperidine]-1'-yl]-2-hydroxypropoxy]-4-hydroxyphenyl]-thiomorpholin-4-ylmethanone |
| SMILES | O=C(c1ccc(O)cc1OC[C@@H](O)CN1CC[C@@]2(Cc3ccccc3O2)CC1Cl)N1CCSCC1 |
| InChI | InChI=1S/C26H31ClN2O5S/c27-24-15-26(14-18-3-1-2-4-22(18)34-26)7-8-29(24)16-20(31)17-33-23-13-19(30)5-6-21(23)25(32)28-9-11-35-12-10-28/h1-6,13,20,24,30-31H,7-12,14-17H2/t20-,24?,26+/m0/s1 |
| InChIKey | RMAAWMWCTMUZAA-KDUSFZBUSA-N |
| XLogP | 3.36 |
| TPSA | 82.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.06 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|