C16H22O3 — CID 67161464
2-(2-cyclohexylphenyl)propan-2-yl hydrogen carbonate (PubChem CID 67161464) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is 2-(2-cyclohexylphenyl)propan-2-yl hydrogen carbonate.
| Compound Name | 2-(2-cyclohexylphenyl)propan-2-yl hydrogen carbonate |
|---|---|
| PubChem CID | 67161464 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | 2-(2-cyclohexylphenyl)propan-2-yl hydrogen carbonate |
| SMILES | CC(C)(OC(=O)O)c1ccccc1C1CCCCC1 |
| InChI | InChI=1S/C16H22O3/c1-16(2,19-15(17)18)14-11-7-6-10-13(14)12-8-4-3-5-9-12/h6-7,10-12H,3-5,8-9H2,1-2H3,(H,17,18) |
| InChIKey | BUPXMKJFABYNEQ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |