C24H34N4O4S — CID 67166110
8-(cyclohexanecarbonyl)-2-(2-methylsulfanylethyl)-4-[(2-nitrophenyl)methyl]-1,4,8-triazaspiro[4.5]decan-3-one (PubChem CID 67166110) has the molecular formula C24H34N4O4S and a molecular weight of 474.63 g/mol. Its IUPAC name is 8-(cyclohexanecarbonyl)-2-(2-methylsulfanylethyl)-4-[(2-nitrophenyl)methyl]-1,4,8-triazaspiro[4.5]decan-3-one.
| Compound Name | 8-(cyclohexanecarbonyl)-2-(2-methylsulfanylethyl)-4-[(2-nitrophenyl)methyl]-1,4,8-triazaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 67166110 |
| Molecular Formula | C24H34N4O4S |
| Molecular Weight | 474.63 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | 8-(cyclohexanecarbonyl)-2-(2-methylsulfanylethyl)-4-[(2-nitrophenyl)methyl]-1,4,8-triazaspiro[4.5]decan-3-one |
| SMILES | CSCCC1NC2(CCN(C(=O)C3CCCCC3)CC2)N(Cc2ccccc2[N+](=O)[O-])C1=O |
| InChI | InChI=1S/C24H34N4O4S/c1-33-16-11-20-23(30)27(17-19-9-5-6-10-21(19)28(31)32)24(25-20)12-14-26(15-13-24)22(29)18-7-3-2-4-8-18/h5-6,9-10,18,20,25H,2-4,7-8,11-17H2,1H3 |
| InChIKey | KQLFTNKHJIVOTE-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.63 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|