C27H34N4O4 — CID 67166436
4-[(3,5-dimethylphenyl)methyl]-2-(2-methylpropyl)-8-(4-nitrobenzoyl)-1,4,8-triazaspiro[4.5]decan-3-one (PubChem CID 67166436) has the molecular formula C27H34N4O4 and a molecular weight of 478.59 g/mol. Its IUPAC name is 4-[(3,5-dimethylphenyl)methyl]-2-(2-methylpropyl)-8-(4-nitrobenzoyl)-1,4,8-triazaspiro[4.5]decan-3-one.
| Compound Name | 4-[(3,5-dimethylphenyl)methyl]-2-(2-methylpropyl)-8-(4-nitrobenzoyl)-1,4,8-triazaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 67166436 |
| Molecular Formula | C27H34N4O4 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | 4-[(3,5-dimethylphenyl)methyl]-2-(2-methylpropyl)-8-(4-nitrobenzoyl)-1,4,8-triazaspiro[4.5]decan-3-one |
| SMILES | Cc1cc(C)cc(CN2C(=O)C(CC(C)C)NC23CCN(C(=O)c2ccc([N+](=O)[O-])cc2)CC3)c1 |
| InChI | InChI=1S/C27H34N4O4/c1-18(2)13-24-26(33)30(17-21-15-19(3)14-20(4)16-21)27(28-24)9-11-29(12-10-27)25(32)22-5-7-23(8-6-22)31(34)35/h5-8,14-16,18,24,28H,9-13,17H2,1-4H3 |
| InChIKey | KVVMSFMHWISNTE-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|