C28H33N3O4S — CID 67166600
benzyl 2-[2-(2-methylsulfanylethyl)-3-oxo-4-prop-2-enyl-1,4,8-triazaspiro[4.5]decane-8-carbonyl]benzoate (PubChem CID 67166600) has the molecular formula C28H33N3O4S and a molecular weight of 507.66 g/mol. Its IUPAC name is benzyl 2-[2-(2-methylsulfanylethyl)-3-oxo-4-prop-2-enyl-1,4,8-triazaspiro[4.5]decane-8-carbonyl]benzoate.
| Compound Name | benzyl 2-[2-(2-methylsulfanylethyl)-3-oxo-4-prop-2-enyl-1,4,8-triazaspiro[4.5]decane-8-carbonyl]benzoate |
|---|---|
| PubChem CID | 67166600 |
| Molecular Formula | C28H33N3O4S |
| Molecular Weight | 507.66 g/mol |
| Exact Mass | 507.22 |
| IUPAC Name | benzyl 2-[2-(2-methylsulfanylethyl)-3-oxo-4-prop-2-enyl-1,4,8-triazaspiro[4.5]decane-8-carbonyl]benzoate |
| SMILES | C=CCN1C(=O)C(CCSC)NC12CCN(C(=O)c1ccccc1C(=O)OCc1ccccc1)CC2 |
| InChI | InChI=1S/C28H33N3O4S/c1-3-16-31-26(33)24(13-19-36-2)29-28(31)14-17-30(18-15-28)25(32)22-11-7-8-12-23(22)27(34)35-20-21-9-5-4-6-10-21/h3-12,24,29H,1,13-20H2,2H3 |
| InChIKey | SCNQYXFRZPPJGW-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.66 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|