C19H20FNO — CID 67167210
(3aS,10bR)-2-benzyl-8-fluoro-1,3,3a,4,5,10b-hexahydro-[1]benzoxepino[4,5-c]pyrrole (PubChem CID 67167210) has the molecular formula C19H20FNO and a molecular weight of 297.37 g/mol. Its IUPAC name is (3aS,10bR)-2-benzyl-8-fluoro-1,3,3a,4,5,10b-hexahydro-[1]benzoxepino[4,5-c]pyrrole.
| Compound Name | (3aS,10bR)-2-benzyl-8-fluoro-1,3,3a,4,5,10b-hexahydro-[1]benzoxepino[4,5-c]pyrrole |
|---|---|
| PubChem CID | 67167210 |
| Molecular Formula | C19H20FNO |
| Molecular Weight | 297.37 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | (3aS,10bR)-2-benzyl-8-fluoro-1,3,3a,4,5,10b-hexahydro-[1]benzoxepino[4,5-c]pyrrole |
| SMILES | Fc1ccc2c(c1)OCC[C@@H]1CN(Cc3ccccc3)C[C@@H]21 |
| InChI | InChI=1S/C19H20FNO/c20-16-6-7-17-18-13-21(11-14-4-2-1-3-5-14)12-15(18)8-9-22-19(17)10-16/h1-7,10,15,18H,8-9,11-13H2/t15-,18-/m1/s1 |
| InChIKey | WJFUJAJWWBLKLX-CRAIPNDOSA-N |
| XLogP | 3.82 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.37 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |