C18H19FN2 — CID 90669760
(4aS,9bS)-2-benzyl-8-fluoro-1,3,4,4a,5,9b-hexahydropyrido[4,3-b]indole (PubChem CID 90669760) has the molecular formula C18H19FN2 and a molecular weight of 282.36 g/mol. Its IUPAC name is (4aS,9bS)-2-benzyl-8-fluoro-1,3,4,4a,5,9b-hexahydropyrido[4,3-b]indole.
| Compound Name | (4aS,9bS)-2-benzyl-8-fluoro-1,3,4,4a,5,9b-hexahydropyrido[4,3-b]indole |
|---|---|
| PubChem CID | 90669760 |
| Molecular Formula | C18H19FN2 |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | (4aS,9bS)-2-benzyl-8-fluoro-1,3,4,4a,5,9b-hexahydropyrido[4,3-b]indole |
| SMILES | Fc1ccc2c(c1)[C@H]1CN(Cc3ccccc3)CC[C@@H]1N2 |
| InChI | InChI=1S/C18H19FN2/c19-14-6-7-17-15(10-14)16-12-21(9-8-18(16)20-17)11-13-4-2-1-3-5-13/h1-7,10,16,18,20H,8-9,11-12H2/t16-,18+/m1/s1 |
| InChIKey | SYWCVKBJTDJGIP-AEFFLSMTSA-N |
| XLogP | 3.61 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |