C34H42F2N4 — CID 22820810
(4aR,9bR)-2-[6-(4-benzylpiperazin-1-yl)hexyl]-8-fluoro-5-(4-fluorophenyl)-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole (PubChem CID 22820810) has the molecular formula C34H42F2N4 and a molecular weight of 544.73 g/mol. Its IUPAC name is (4aR,9bR)-2-[6-(4-benzylpiperazin-1-yl)hexyl]-8-fluoro-5-(4-fluorophenyl)-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole.
| Compound Name | (4aR,9bR)-2-[6-(4-benzylpiperazin-1-yl)hexyl]-8-fluoro-5-(4-fluorophenyl)-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 22820810 |
| Molecular Formula | C34H42F2N4 |
| Molecular Weight | 544.73 g/mol |
| Exact Mass | 544.34 |
| IUPAC Name | (4aR,9bR)-2-[6-(4-benzylpiperazin-1-yl)hexyl]-8-fluoro-5-(4-fluorophenyl)-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole |
| SMILES | Fc1ccc(N2c3ccc(F)cc3[C@@H]3CN(CCCCCCN4CCN(Cc5ccccc5)CC4)CC[C@H]32)cc1 |
| InChI | InChI=1S/C34H42F2N4/c35-28-10-13-30(14-11-28)40-33-15-12-29(36)24-31(33)32-26-38(19-16-34(32)40)18-7-2-1-6-17-37-20-22-39(23-21-37)25-27-8-4-3-5-9-27/h3-5,8-15,24,32,34H,1-2,6-7,16-23,25-26H2/t32-,34+/m0/s1 |
| InChIKey | AIJXJTXQALMOKS-UZNNEEJFSA-N |
| XLogP | 6.65 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.73 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|