C26H31ClF2N4O2 — CID 45260358
3-[6-[6-fluoro-9-(4-fluorophenyl)-3,4,4a,9a-tetrahydro-1H-pyrido[3,4-b]indol-2-yl]hexyl]imidazolidine-2,4-dione;hydrochloride (PubChem CID 45260358) has the molecular formula C26H31ClF2N4O2 and a molecular weight of 505.01 g/mol. Its IUPAC name is 3-[6-[6-fluoro-9-(4-fluorophenyl)-3,4,4a,9a-tetrahydro-1H-pyrido[3,4-b]indol-2-yl]hexyl]imidazolidine-2,4-dione;hydrochloride.
| Compound Name | 3-[6-[6-fluoro-9-(4-fluorophenyl)-3,4,4a,9a-tetrahydro-1H-pyrido[3,4-b]indol-2-yl]hexyl]imidazolidine-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 45260358 |
| Molecular Formula | C26H31ClF2N4O2 |
| Molecular Weight | 505.01 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | 3-[6-[6-fluoro-9-(4-fluorophenyl)-3,4,4a,9a-tetrahydro-1H-pyrido[3,4-b]indol-2-yl]hexyl]imidazolidine-2,4-dione;hydrochloride |
| SMILES | Cl.O=C1CNC(=O)N1CCCCCCN1CCC2c3cc(F)ccc3N(c3ccc(F)cc3)C2C1 |
| InChI | InChI=1S/C26H30F2N4O2.ClH/c27-18-5-8-20(9-6-18)32-23-10-7-19(28)15-22(23)21-11-14-30(17-24(21)32)12-3-1-2-4-13-31-25(33)16-29-26(31)34;/h5-10,15,21,24H,1-4,11-14,16-17H2,(H,29,34);1H |
| InChIKey | LHJGMBPSLULHJD-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.01 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|