C21H26ClF2N3 — CID 12855264
4-[8-fluoro-5-(4-fluorophenyl)-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-2-yl]butan-1-amine;hydrochloride (PubChem CID 12855264) has the molecular formula C21H26ClF2N3 and a molecular weight of 393.91 g/mol. Its IUPAC name is 4-[8-fluoro-5-(4-fluorophenyl)-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-2-yl]butan-1-amine;hydrochloride.
| Compound Name | 4-[8-fluoro-5-(4-fluorophenyl)-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-2-yl]butan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 12855264 |
| Molecular Formula | C21H26ClF2N3 |
| Molecular Weight | 393.91 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | 4-[8-fluoro-5-(4-fluorophenyl)-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-2-yl]butan-1-amine;hydrochloride |
| SMILES | Cl.NCCCCN1CCC2C(C1)c1cc(F)ccc1N2c1ccc(F)cc1 |
| InChI | InChI=1S/C21H25F2N3.ClH/c22-15-3-6-17(7-4-15)26-20-8-5-16(23)13-18(20)19-14-25(11-2-1-10-24)12-9-21(19)26;/h3-8,13,19,21H,1-2,9-12,14,24H2;1H |
| InChIKey | ZOWDNIRXKYMRQW-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.91 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|