C23H28F2N4 — CID 57039212
5-[(4aR,9bR)-8-fluoro-5-(4-fluorophenyl)-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-2-yl]pentyl-methyldiazene (PubChem CID 57039212) has the molecular formula C23H28F2N4 and a molecular weight of 398.50 g/mol. Its IUPAC name is 5-[(4aR,9bR)-8-fluoro-5-(4-fluorophenyl)-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-2-yl]pentyl-methyldiazene.
| Compound Name | 5-[(4aR,9bR)-8-fluoro-5-(4-fluorophenyl)-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-2-yl]pentyl-methyldiazene |
|---|---|
| PubChem CID | 57039212 |
| Molecular Formula | C23H28F2N4 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | 5-[(4aR,9bR)-8-fluoro-5-(4-fluorophenyl)-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-2-yl]pentyl-methyldiazene |
| SMILES | C/N=N/CCCCCN1CC[C@@H]2[C@@H](C1)c1cc(F)ccc1N2c1ccc(F)cc1 |
| InChI | InChI=1S/C23H28F2N4/c1-26-27-12-3-2-4-13-28-14-11-23-21(16-28)20-15-18(25)7-10-22(20)29(23)19-8-5-17(24)6-9-19/h5-10,15,21,23H,2-4,11-14,16H2,1H3/b27-26+/t21-,23+/m0/s1 |
| InChIKey | ULJOKMFARLJWJN-DZPSMEBYSA-N |
| XLogP | 5.53 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|