C27H34ClF2N3O — CID 22820728
1-[4-[(4aR,9bR)-8-fluoro-5-(4-fluorophenyl)-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-2-yl]butyl]azepan-2-one;hydrochloride (PubChem CID 22820728) has the molecular formula C27H34ClF2N3O and a molecular weight of 490.04 g/mol. Its IUPAC name is 1-[4-[(4aR,9bR)-8-fluoro-5-(4-fluorophenyl)-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-2-yl]butyl]azepan-2-one;hydrochloride.
| Compound Name | 1-[4-[(4aR,9bR)-8-fluoro-5-(4-fluorophenyl)-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-2-yl]butyl]azepan-2-one;hydrochloride |
|---|---|
| PubChem CID | 22820728 |
| Molecular Formula | C27H34ClF2N3O |
| Molecular Weight | 490.04 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | 1-[4-[(4aR,9bR)-8-fluoro-5-(4-fluorophenyl)-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-2-yl]butyl]azepan-2-one;hydrochloride |
| SMILES | Cl.O=C1CCCCCN1CCCCN1CC[C@@H]2[C@@H](C1)c1cc(F)ccc1N2c1ccc(F)cc1 |
| InChI | InChI=1S/C27H33F2N3O.ClH/c28-20-7-10-22(11-8-20)32-25-12-9-21(29)18-23(25)24-19-30(17-13-26(24)32)14-4-5-16-31-15-3-1-2-6-27(31)33;/h7-12,18,24,26H,1-6,13-17,19H2;1H/t24-,26+;/m0./s1 |
| InChIKey | GVMNVDLZJFVXFV-ZFGDHOEWSA-N |
| XLogP | 5.88 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.04 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|