C27H34F2N4O — CID 22820671
1-[4-[2-[(4aR,9bR)-8-fluoro-5-(4-fluorophenyl)-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-2-yl]ethyl]piperazin-1-yl]-2-methylpropan-1-one (PubChem CID 22820671) has the molecular formula C27H34F2N4O and a molecular weight of 468.59 g/mol. Its IUPAC name is 1-[4-[2-[(4aR,9bR)-8-fluoro-5-(4-fluorophenyl)-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-2-yl]ethyl]piperazin-1-yl]-2-methylpropan-1-one.
| Compound Name | 1-[4-[2-[(4aR,9bR)-8-fluoro-5-(4-fluorophenyl)-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-2-yl]ethyl]piperazin-1-yl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 22820671 |
| Molecular Formula | C27H34F2N4O |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | 1-[4-[2-[(4aR,9bR)-8-fluoro-5-(4-fluorophenyl)-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-2-yl]ethyl]piperazin-1-yl]-2-methylpropan-1-one |
| SMILES | CC(C)C(=O)N1CCN(CCN2CC[C@@H]3[C@@H](C2)c2cc(F)ccc2N3c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C27H34F2N4O/c1-19(2)27(34)32-15-13-30(14-16-32)11-12-31-10-9-26-24(18-31)23-17-21(29)5-8-25(23)33(26)22-6-3-20(28)4-7-22/h3-8,17,19,24,26H,9-16,18H2,1-2H3/t24-,26+/m0/s1 |
| InChIKey | UTFXZHBEEHLJBL-AZGAKELHSA-N |
| XLogP | 4.07 |
| TPSA | 30.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |