C21H30F2N2O2S — CID 67167812
4-cyclopentylsulfanyl-N-[[4-[(3,4-difluorophenyl)methyl]morpholin-2-yl]methyl]butanamide (PubChem CID 67167812) has the molecular formula C21H30F2N2O2S and a molecular weight of 412.55 g/mol. Its IUPAC name is 4-cyclopentylsulfanyl-N-[[4-[(3,4-difluorophenyl)methyl]morpholin-2-yl]methyl]butanamide.
| Compound Name | 4-cyclopentylsulfanyl-N-[[4-[(3,4-difluorophenyl)methyl]morpholin-2-yl]methyl]butanamide |
|---|---|
| PubChem CID | 67167812 |
| Molecular Formula | C21H30F2N2O2S |
| Molecular Weight | 412.55 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 4-cyclopentylsulfanyl-N-[[4-[(3,4-difluorophenyl)methyl]morpholin-2-yl]methyl]butanamide |
| SMILES | O=C(CCCSC1CCCC1)NCC1CN(Cc2ccc(F)c(F)c2)CCO1 |
| InChI | InChI=1S/C21H30F2N2O2S/c22-19-8-7-16(12-20(19)23)14-25-9-10-27-17(15-25)13-24-21(26)6-3-11-28-18-4-1-2-5-18/h7-8,12,17-18H,1-6,9-11,13-15H2,(H,24,26) |
| InChIKey | ZWBKATGTHQEHPV-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.55 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|