C21H31ClN2O4S — CID 67169119
N-[[4-[(3-chlorophenyl)methyl]morpholin-2-yl]methyl]-4-cyclopentylsulfonylbutanamide (PubChem CID 67169119) has the molecular formula C21H31ClN2O4S and a molecular weight of 443.01 g/mol. Its IUPAC name is N-[[4-[(3-chlorophenyl)methyl]morpholin-2-yl]methyl]-4-cyclopentylsulfonylbutanamide.
| Compound Name | N-[[4-[(3-chlorophenyl)methyl]morpholin-2-yl]methyl]-4-cyclopentylsulfonylbutanamide |
|---|---|
| PubChem CID | 67169119 |
| Molecular Formula | C21H31ClN2O4S |
| Molecular Weight | 443.01 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | N-[[4-[(3-chlorophenyl)methyl]morpholin-2-yl]methyl]-4-cyclopentylsulfonylbutanamide |
| SMILES | O=C(CCCS(=O)(=O)C1CCCC1)NCC1CN(Cc2cccc(Cl)c2)CCO1 |
| InChI | InChI=1S/C21H31ClN2O4S/c22-18-6-3-5-17(13-18)15-24-10-11-28-19(16-24)14-23-21(25)9-4-12-29(26,27)20-7-1-2-8-20/h3,5-6,13,19-20H,1-2,4,7-12,14-16H2,(H,23,25) |
| InChIKey | SYBYLLCMNGJGCN-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.01 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |