C21H28N2O2 — CID 67167956
N-[2-[2-(3,5-dimethoxyphenyl)phenyl]ethyl]piperidin-4-amine (PubChem CID 67167956) has the molecular formula C21H28N2O2 and a molecular weight of 340.47 g/mol. Its IUPAC name is N-[2-[2-(3,5-dimethoxyphenyl)phenyl]ethyl]piperidin-4-amine.
| Compound Name | N-[2-[2-(3,5-dimethoxyphenyl)phenyl]ethyl]piperidin-4-amine |
|---|---|
| PubChem CID | 67167956 |
| Molecular Formula | C21H28N2O2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | N-[2-[2-(3,5-dimethoxyphenyl)phenyl]ethyl]piperidin-4-amine |
| SMILES | COc1cc(OC)cc(-c2ccccc2CCNC2CCNCC2)c1 |
| InChI | InChI=1S/C21H28N2O2/c1-24-19-13-17(14-20(15-19)25-2)21-6-4-3-5-16(21)7-12-23-18-8-10-22-11-9-18/h3-6,13-15,18,22-23H,7-12H2,1-2H3 |
| InChIKey | FIWWVXOGEQAKKV-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |