C17H23NO7 — CID 67173628
(2S)-3-[[(1S)-1-acetyloxyethoxy]carbonylamino]-2-(3-propylphenoxy)propanoic acid (PubChem CID 67173628) has the molecular formula C17H23NO7 and a molecular weight of 353.37 g/mol. Its IUPAC name is (2S)-3-[[(1S)-1-acetyloxyethoxy]carbonylamino]-2-(3-propylphenoxy)propanoic acid.
| Compound Name | (2S)-3-[[(1S)-1-acetyloxyethoxy]carbonylamino]-2-(3-propylphenoxy)propanoic acid |
|---|---|
| PubChem CID | 67173628 |
| Molecular Formula | C17H23NO7 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | (2S)-3-[[(1S)-1-acetyloxyethoxy]carbonylamino]-2-(3-propylphenoxy)propanoic acid |
| SMILES | CCCc1cccc(O[C@@H](CNC(=O)O[C@@H](C)OC(C)=O)C(=O)O)c1 |
| InChI | InChI=1S/C17H23NO7/c1-4-6-13-7-5-8-14(9-13)25-15(16(20)21)10-18-17(22)24-12(3)23-11(2)19/h5,7-9,12,15H,4,6,10H2,1-3H3,(H,18,22)(H,20,21)/t12-,15-/m0/s1 |
| InChIKey | YILZWGCMUNNSBC-WFASDCNBSA-N |
| XLogP | 2.11 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|