C16H18F3NO6 — CID 67172578
(2S)-2-[[[(1R)-1-acetyloxyethoxy]carbonylamino]methyl]-3-[3-(trifluoromethyl)phenyl]propanoic acid (PubChem CID 67172578) has the molecular formula C16H18F3NO6 and a molecular weight of 377.32 g/mol. Its IUPAC name is (2S)-2-[[[(1R)-1-acetyloxyethoxy]carbonylamino]methyl]-3-[3-(trifluoromethyl)phenyl]propanoic acid.
| Compound Name | (2S)-2-[[[(1R)-1-acetyloxyethoxy]carbonylamino]methyl]-3-[3-(trifluoromethyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 67172578 |
| Molecular Formula | C16H18F3NO6 |
| Molecular Weight | 377.32 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | (2S)-2-[[[(1R)-1-acetyloxyethoxy]carbonylamino]methyl]-3-[3-(trifluoromethyl)phenyl]propanoic acid |
| SMILES | CC(=O)O[C@@H](C)OC(=O)NCC(Cc1cccc(C(F)(F)F)c1)C(=O)O |
| InChI | InChI=1S/C16H18F3NO6/c1-9(21)25-10(2)26-15(24)20-8-12(14(22)23)6-11-4-3-5-13(7-11)16(17,18)19/h3-5,7,10,12H,6,8H2,1-2H3,(H,20,24)(H,22,23)/t10-,12?/m1/s1 |
| InChIKey | ICOSOYFNUXQDBB-RWANSRKNSA-N |
| XLogP | 2.58 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|