C8H18INO2 — CID 67174361
N,N-dimethyl-1-[(2S,4R)-2-methyl-1,3-dioxolan-4-yl]methanamine;iodomethane (PubChem CID 67174361) has the molecular formula C8H18INO2 and a molecular weight of 287.14 g/mol. Its IUPAC name is N,N-dimethyl-1-[(2S,4R)-2-methyl-1,3-dioxolan-4-yl]methanamine;iodomethane.
| Compound Name | N,N-dimethyl-1-[(2S,4R)-2-methyl-1,3-dioxolan-4-yl]methanamine;iodomethane |
|---|---|
| PubChem CID | 67174361 |
| Molecular Formula | C8H18INO2 |
| Molecular Weight | 287.14 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | N,N-dimethyl-1-[(2S,4R)-2-methyl-1,3-dioxolan-4-yl]methanamine;iodomethane |
| SMILES | CI.C[C@H]1OC[C@@H](CN(C)C)O1 |
| InChI | InChI=1S/C7H15NO2.CH3I/c1-6-9-5-7(10-6)4-8(2)3;1-2/h6-7H,4-5H2,1-3H3;1H3/t6-,7+;/m0./s1 |
| InChIKey | JMCOFHMOTYNBOC-UOERWJHTSA-N |
| XLogP | 1.36 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.14 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|