C17H31IN4O4 — CID 67174981
tert-butyl 4-(2-iodoacetyl)piperazine-1-carboxylate;1-piperazin-1-ylethanone (PubChem CID 67174981) has the molecular formula C17H31IN4O4 and a molecular weight of 482.36 g/mol. Its IUPAC name is tert-butyl 4-(2-iodoacetyl)piperazine-1-carboxylate;1-piperazin-1-ylethanone.
| Compound Name | tert-butyl 4-(2-iodoacetyl)piperazine-1-carboxylate;1-piperazin-1-ylethanone |
|---|---|
| PubChem CID | 67174981 |
| Molecular Formula | C17H31IN4O4 |
| Molecular Weight | 482.36 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | tert-butyl 4-(2-iodoacetyl)piperazine-1-carboxylate;1-piperazin-1-ylethanone |
| SMILES | CC(=O)N1CCNCC1.CC(C)(C)OC(=O)N1CCN(C(=O)CI)CC1 |
| InChI | InChI=1S/C11H19IN2O3.C6H12N2O/c1-11(2,3)17-10(16)14-6-4-13(5-7-14)9(15)8-12;1-6(9)8-4-2-7-3-5-8/h4-8H2,1-3H3;7H,2-5H2,1H3 |
| InChIKey | BOEUECUHUCWGOB-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.36 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|