C21H26N2 — CID 67175624
(3R)-3-phenyl-1-[[(2S,4R)-4-phenylpyrrolidin-2-yl]methyl]pyrrolidine (PubChem CID 67175624) has the molecular formula C21H26N2 and a molecular weight of 306.45 g/mol. Its IUPAC name is (3R)-3-phenyl-1-[[(2S,4R)-4-phenylpyrrolidin-2-yl]methyl]pyrrolidine.
| Compound Name | (3R)-3-phenyl-1-[[(2S,4R)-4-phenylpyrrolidin-2-yl]methyl]pyrrolidine |
|---|---|
| PubChem CID | 67175624 |
| Molecular Formula | C21H26N2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | (3R)-3-phenyl-1-[[(2S,4R)-4-phenylpyrrolidin-2-yl]methyl]pyrrolidine |
| SMILES | c1ccc([C@@H]2CN[C@H](CN3CC[C@H](c4ccccc4)C3)C2)cc1 |
| InChI | InChI=1S/C21H26N2/c1-3-7-17(8-4-1)19-11-12-23(15-19)16-21-13-20(14-22-21)18-9-5-2-6-10-18/h1-10,19-22H,11-16H2/t19-,20-,21-/m0/s1 |
| InChIKey | AMQJWKXCLYHLOU-ACRUOGEOSA-N |
| XLogP | 3.62 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |