C11H16N2 — CID 57365027
[(2S,4R)-4-phenylpyrrolidin-2-yl]methanamine (PubChem CID 57365027) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is [(2S,4R)-4-phenylpyrrolidin-2-yl]methanamine.
| Compound Name | [(2S,4R)-4-phenylpyrrolidin-2-yl]methanamine |
|---|---|
| PubChem CID | 57365027 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | [(2S,4R)-4-phenylpyrrolidin-2-yl]methanamine |
| SMILES | NC[C@@H]1C[C@H](c2ccccc2)CN1 |
| InChI | InChI=1S/C11H16N2/c12-7-11-6-10(8-13-11)9-4-2-1-3-5-9/h1-5,10-11,13H,6-8,12H2/t10-,11-/m0/s1 |
| InChIKey | GZBRSIAGVAWGNO-QWRGUYRKSA-N |
| XLogP | 1.09 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |