C15H22N2 — CID 122440726
[2-[(1S,2R)-2-phenylcyclopropyl]piperidin-4-yl]methanamine (PubChem CID 122440726) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is [2-[(1S,2R)-2-phenylcyclopropyl]piperidin-4-yl]methanamine.
| Compound Name | [2-[(1S,2R)-2-phenylcyclopropyl]piperidin-4-yl]methanamine |
|---|---|
| PubChem CID | 122440726 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | [2-[(1S,2R)-2-phenylcyclopropyl]piperidin-4-yl]methanamine |
| SMILES | NCC1CCNC([C@H]2C[C@H]2c2ccccc2)C1 |
| InChI | InChI=1S/C15H22N2/c16-10-11-6-7-17-15(8-11)14-9-13(14)12-4-2-1-3-5-12/h1-5,11,13-15,17H,6-10,16H2/t11?,13-,14-,15?/m0/s1 |
| InChIKey | HCSCFSFBHXJAMT-IFFKYPLHSA-N |
| XLogP | 2.12 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |