C12H17N — CID 95374662
(2R,5S)-2-methyl-5-phenylpiperidine (PubChem CID 95374662) has the molecular formula C12H17N and a molecular weight of 175.28 g/mol. Its IUPAC name is (2R,5S)-2-methyl-5-phenylpiperidine.
| Compound Name | (2R,5S)-2-methyl-5-phenylpiperidine |
|---|---|
| PubChem CID | 95374662 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.28 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | (2R,5S)-2-methyl-5-phenylpiperidine |
| SMILES | C[C@@H]1CC[C@@H](c2ccccc2)CN1 |
| InChI | InChI=1S/C12H17N/c1-10-7-8-12(9-13-10)11-5-3-2-4-6-11/h2-6,10,12-13H,7-9H2,1H3/t10-,12-/m1/s1 |
| InChIKey | MDNNQUKRMONUEH-ZYHUDNBSSA-N |
| XLogP | 2.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.28 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |