About (2'R)-2-amino-6'-bromo-2'-phenyl-2'-propylspiro[1H-imidazole-4,4'-3H-chromene]-5-one
(2'R)-2-amino-6'-bromo-2'-phenyl-2'-propylspiro[1H-imidazole-4,4'-3H-chromene]-5-one (PubChem CID 67175919) has the molecular formula C20H20BrN3O2
and a molecular weight of 414.30 g/mol. Its IUPAC name is (2'R)-2-amino-6'-bromo-2'-phenyl-2'-propylspiro[1H-imidazole-4,4'-3H-chromene]-5-one.
Molecular Properties
| Compound Name | (2'R)-2-amino-6'-bromo-2'-phenyl-2'-propylspiro[1H-imidazole-4,4'-3H-chromene]-5-one |
| PubChem CID | 67175919 |
| Molecular Formula | C20H20BrN3O2 |
| Molecular Weight | 414.30 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | (2'R)-2-amino-6'-bromo-2'-phenyl-2'-propylspiro[1H-imidazole-4,4'-3H-chromene]-5-one |
| SMILES | CCC[C@]1(c2ccccc2)CC2(N=C(N)NC2=O)c2cc(Br)ccc2O1 |
| InChI | InChI=1S/C20H20BrN3O2/c1-2-10-19(13-6-4-3-5-7-13)12-20(17(25)23-18(22)24-20)15-11-14(21)8-9-16(15)26-19/h3-9,11H,2,10,12H2,1H3,(H3,22,23,24,25)/t19-,20?/m1/s1 |
| InChIKey | KDIWNWUPWCXMAO-FIWHBWSRSA-N |
| XLogP | 3.57 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.30 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2'R)-2-amino-6'-bromo-2'-phenyl-2'-propylspiro[1H-imidazole-4,4'-3H-chromene]-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2'R)-2-amino-6'-bromo-2'-phenyl-2'-propylspiro[1H-imidazole-4,4'-3H-chromene]-5-one?
The IUPAC name of (2'R)-2-amino-6'-bromo-2'-phenyl-2'-propylspiro[1H-imidazole-4,4'-3H-chromene]-5-one (CID 67175919) is (2'R)-2-amino-6'-bromo-2'-phenyl-2'-propylspiro[1H-imidazole-4,4'-3H-chromene]-5-one.
What is the SMILES notation for (2'R)-2-amino-6'-bromo-2'-phenyl-2'-propylspiro[1H-imidazole-4,4'-3H-chromene]-5-one?
The canonical SMILES for (2'R)-2-amino-6'-bromo-2'-phenyl-2'-propylspiro[1H-imidazole-4,4'-3H-chromene]-5-one is CCC[C@]1(c2ccccc2)CC2(N=C(N)NC2=O)c2cc(Br)ccc2O1.
What is the InChIKey of (2'R)-2-amino-6'-bromo-2'-phenyl-2'-propylspiro[1H-imidazole-4,4'-3H-chromene]-5-one?
The InChIKey is KDIWNWUPWCXMAO-FIWHBWSRSA-N. The full InChI is InChI=1S/C20H20BrN3O2/c1-2-10-19(13-6-4-3-5-7-13)12-20(17(25)23-18(22)24-20)15-11-14(21)8-9-16(15)26-19/h3-9,11H,2,10,12H2,1H3,(H3,22,23,24,25)/t19-,20?/m1/s1.
What are the key properties of (2'R)-2-amino-6'-bromo-2'-phenyl-2'-propylspiro[1H-imidazole-4,4'-3H-chromene]-5-one?
(2'R)-2-amino-6'-bromo-2'-phenyl-2'-propylspiro[1H-imidazole-4,4'-3H-chromene]-5-one has a molecular weight of 414.30 g/mol, XLogP of 3.57, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2'R)-2-amino-6'-bromo-2'-phenyl-2'-propylspiro[1H-imidazole-4,4'-3H-chromene]-5-one is sourced from PubChem (CID 67175919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).