C24H39NO6S2 — CID 70577659
2-methyl-4,4-bis(2-methylsulfonylethyl)-2-propylchromen-3-one;piperidine (PubChem CID 70577659) has the molecular formula C24H39NO6S2 and a molecular weight of 501.71 g/mol. Its IUPAC name is 2-methyl-4,4-bis(2-methylsulfonylethyl)-2-propylchromen-3-one;piperidine.
| Compound Name | 2-methyl-4,4-bis(2-methylsulfonylethyl)-2-propylchromen-3-one;piperidine |
|---|---|
| PubChem CID | 70577659 |
| Molecular Formula | C24H39NO6S2 |
| Molecular Weight | 501.71 g/mol |
| Exact Mass | 501.22 |
| IUPAC Name | 2-methyl-4,4-bis(2-methylsulfonylethyl)-2-propylchromen-3-one;piperidine |
| SMILES | C1CCNCC1.CCCC1(C)Oc2ccccc2C(CCS(C)(=O)=O)(CCS(C)(=O)=O)C1=O |
| InChI | InChI=1S/C19H28O6S2.C5H11N/c1-5-10-18(2)17(20)19(11-13-26(3,21)22,12-14-27(4,23)24)15-8-6-7-9-16(15)25-18;1-2-4-6-5-3-1/h6-9H,5,10-14H2,1-4H3;6H,1-5H2 |
| InChIKey | WNENZYYUPIDVQJ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.71 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |