C22H35NO6S2 — CID 70575617
2-[3-(diethylamino)propyl]-2,4-bis(2-methylsulfonylethyl)-4H-chromen-3-one (PubChem CID 70575617) has the molecular formula C22H35NO6S2 and a molecular weight of 473.66 g/mol. Its IUPAC name is 2-[3-(diethylamino)propyl]-2,4-bis(2-methylsulfonylethyl)-4H-chromen-3-one.
| Compound Name | 2-[3-(diethylamino)propyl]-2,4-bis(2-methylsulfonylethyl)-4H-chromen-3-one |
|---|---|
| PubChem CID | 70575617 |
| Molecular Formula | C22H35NO6S2 |
| Molecular Weight | 473.66 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | 2-[3-(diethylamino)propyl]-2,4-bis(2-methylsulfonylethyl)-4H-chromen-3-one |
| SMILES | CCN(CC)CCCC1(CCS(C)(=O)=O)Oc2ccccc2C(CCS(C)(=O)=O)C1=O |
| InChI | InChI=1S/C22H35NO6S2/c1-5-23(6-2)15-9-13-22(14-17-31(4,27)28)21(24)19(12-16-30(3,25)26)18-10-7-8-11-20(18)29-22/h7-8,10-11,19H,5-6,9,12-17H2,1-4H3 |
| InChIKey | ZWRDLDXZZOYAOI-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.66 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |