C30H54O4 — CID 67180575
2,3,4-tris(2-pentoxypropyl)phenol (PubChem CID 67180575) has the molecular formula C30H54O4 and a molecular weight of 478.76 g/mol. Its IUPAC name is 2,3,4-tris(2-pentoxypropyl)phenol.
| Compound Name | 2,3,4-tris(2-pentoxypropyl)phenol |
|---|---|
| PubChem CID | 67180575 |
| Molecular Formula | C30H54O4 |
| Molecular Weight | 478.76 g/mol |
| Exact Mass | 478.40 |
| IUPAC Name | 2,3,4-tris(2-pentoxypropyl)phenol |
| SMILES | CCCCCOC(C)Cc1ccc(O)c(CC(C)OCCCCC)c1CC(C)OCCCCC |
| InChI | InChI=1S/C30H54O4/c1-7-10-13-18-32-24(4)21-27-16-17-30(31)29(23-26(6)34-20-15-12-9-3)28(27)22-25(5)33-19-14-11-8-2/h16-17,24-26,31H,7-15,18-23H2,1-6H3 |
| InChIKey | VELQCFWHXRWGLC-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.76 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|