C17H22FNO5 — CID 67183663
benzyl 3-fluoro-4-[(2-methylpropan-2-yl)oxycarbonyloxy]pyrrolidine-1-carboxylate (PubChem CID 67183663) has the molecular formula C17H22FNO5 and a molecular weight of 339.36 g/mol. Its IUPAC name is benzyl 3-fluoro-4-[(2-methylpropan-2-yl)oxycarbonyloxy]pyrrolidine-1-carboxylate.
| Compound Name | benzyl 3-fluoro-4-[(2-methylpropan-2-yl)oxycarbonyloxy]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 67183663 |
| Molecular Formula | C17H22FNO5 |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | benzyl 3-fluoro-4-[(2-methylpropan-2-yl)oxycarbonyloxy]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)OC1CN(C(=O)OCc2ccccc2)CC1F |
| InChI | InChI=1S/C17H22FNO5/c1-17(2,3)24-16(21)23-14-10-19(9-13(14)18)15(20)22-11-12-7-5-4-6-8-12/h4-8,13-14H,9-11H2,1-3H3 |
| InChIKey | QWCPPAAJEATXLZ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |