C29H46N4O2 — CID 67184843
3-[8-[2-[cyclohexylmethyl(pentylcarbamoyl)amino]ethyl]-8-azabicyclo[3.2.1]octan-3-yl]benzamide (PubChem CID 67184843) has the molecular formula C29H46N4O2 and a molecular weight of 482.71 g/mol. Its IUPAC name is 3-[8-[2-[cyclohexylmethyl(pentylcarbamoyl)amino]ethyl]-8-azabicyclo[3.2.1]octan-3-yl]benzamide.
| Compound Name | 3-[8-[2-[cyclohexylmethyl(pentylcarbamoyl)amino]ethyl]-8-azabicyclo[3.2.1]octan-3-yl]benzamide |
|---|---|
| PubChem CID | 67184843 |
| Molecular Formula | C29H46N4O2 |
| Molecular Weight | 482.71 g/mol |
| Exact Mass | 482.36 |
| IUPAC Name | 3-[8-[2-[cyclohexylmethyl(pentylcarbamoyl)amino]ethyl]-8-azabicyclo[3.2.1]octan-3-yl]benzamide |
| SMILES | CCCCCNC(=O)N(CCN1C2CCC1CC(c1cccc(C(N)=O)c1)C2)CC1CCCCC1 |
| InChI | InChI=1S/C29H46N4O2/c1-2-3-7-15-31-29(35)32(21-22-9-5-4-6-10-22)16-17-33-26-13-14-27(33)20-25(19-26)23-11-8-12-24(18-23)28(30)34/h8,11-12,18,22,25-27H,2-7,9-10,13-17,19-21H2,1H3,(H2,30,34)(H,31,35) |
| InChIKey | GWDBIKQKJSMRNQ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.71 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|