C15H9BrClFS — CID 67184849
7-bromo-2-[(3-chloro-5-fluorophenyl)methyl]-1-benzothiophene (PubChem CID 67184849) has the molecular formula C15H9BrClFS and a molecular weight of 355.66 g/mol. Its IUPAC name is 7-bromo-2-[(3-chloro-5-fluorophenyl)methyl]-1-benzothiophene.
| Compound Name | 7-bromo-2-[(3-chloro-5-fluorophenyl)methyl]-1-benzothiophene |
|---|---|
| PubChem CID | 67184849 |
| Molecular Formula | C15H9BrClFS |
| Molecular Weight | 355.66 g/mol |
| Exact Mass | 353.93 |
| IUPAC Name | 7-bromo-2-[(3-chloro-5-fluorophenyl)methyl]-1-benzothiophene |
| SMILES | Fc1cc(Cl)cc(Cc2cc3cccc(Br)c3s2)c1 |
| InChI | InChI=1S/C15H9BrClFS/c16-14-3-1-2-10-7-13(19-15(10)14)6-9-4-11(17)8-12(18)5-9/h1-5,7-8H,6H2 |
| InChIKey | RRCWGUIKOMLXHL-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.66 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |