C17H13FO3S — CID 67185568
3-fluoro-5-[2-(hydroxymethyl)-3-methyl-1-benzothiophen-7-yl]benzoic acid (PubChem CID 67185568) has the molecular formula C17H13FO3S and a molecular weight of 316.35 g/mol. Its IUPAC name is 3-fluoro-5-[2-(hydroxymethyl)-3-methyl-1-benzothiophen-7-yl]benzoic acid.
| Compound Name | 3-fluoro-5-[2-(hydroxymethyl)-3-methyl-1-benzothiophen-7-yl]benzoic acid |
|---|---|
| PubChem CID | 67185568 |
| Molecular Formula | C17H13FO3S |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 3-fluoro-5-[2-(hydroxymethyl)-3-methyl-1-benzothiophen-7-yl]benzoic acid |
| SMILES | Cc1c(CO)sc2c(-c3cc(F)cc(C(=O)O)c3)cccc12 |
| InChI | InChI=1S/C17H13FO3S/c1-9-13-3-2-4-14(16(13)22-15(9)8-19)10-5-11(17(20)21)7-12(18)6-10/h2-7,19H,8H2,1H3,(H,20,21) |
| InChIKey | JFWYOJLZDBENCA-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |