C16H13BrOS — CID 67186584
[7-(3-bromophenyl)-3-methyl-1-benzothiophen-2-yl]methanol (PubChem CID 67186584) has the molecular formula C16H13BrOS and a molecular weight of 333.25 g/mol. Its IUPAC name is [7-(3-bromophenyl)-3-methyl-1-benzothiophen-2-yl]methanol.
| Compound Name | [7-(3-bromophenyl)-3-methyl-1-benzothiophen-2-yl]methanol |
|---|---|
| PubChem CID | 67186584 |
| Molecular Formula | C16H13BrOS |
| Molecular Weight | 333.25 g/mol |
| Exact Mass | 331.99 |
| IUPAC Name | [7-(3-bromophenyl)-3-methyl-1-benzothiophen-2-yl]methanol |
| SMILES | Cc1c(CO)sc2c(-c3cccc(Br)c3)cccc12 |
| InChI | InChI=1S/C16H13BrOS/c1-10-13-6-3-7-14(16(13)19-15(10)9-18)11-4-2-5-12(17)8-11/h2-8,18H,9H2,1H3 |
| InChIKey | XIXZLOHCXHRENM-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.25 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |