C24H27ClN4O2 — CID 67191904
2-(4-chlorophenyl)-N-[3-(2-methylpyrazol-3-yl)-4-(piperidin-4-ylmethoxy)phenyl]acetamide (PubChem CID 67191904) has the molecular formula C24H27ClN4O2 and a molecular weight of 438.96 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[3-(2-methylpyrazol-3-yl)-4-(piperidin-4-ylmethoxy)phenyl]acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-[3-(2-methylpyrazol-3-yl)-4-(piperidin-4-ylmethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 67191904 |
| Molecular Formula | C24H27ClN4O2 |
| Molecular Weight | 438.96 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[3-(2-methylpyrazol-3-yl)-4-(piperidin-4-ylmethoxy)phenyl]acetamide |
| SMILES | Cn1nccc1-c1cc(NC(=O)Cc2ccc(Cl)cc2)ccc1OCC1CCNCC1 |
| InChI | InChI=1S/C24H27ClN4O2/c1-29-22(10-13-27-29)21-15-20(28-24(30)14-17-2-4-19(25)5-3-17)6-7-23(21)31-16-18-8-11-26-12-9-18/h2-7,10,13,15,18,26H,8-9,11-12,14,16H2,1H3,(H,28,30) |
| InChIKey | NJAXKJHZZWTTNL-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.96 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |