C29H43N3O3 — CID 67192406
3-[1-hydroxy-5-methoxy-1-[2-(3-methylphenyl)phenyl]pentyl]-N-[1-(methylamino)propan-2-yl]piperidine-1-carboxamide (PubChem CID 67192406) has the molecular formula C29H43N3O3 and a molecular weight of 481.68 g/mol. Its IUPAC name is 3-[1-hydroxy-5-methoxy-1-[2-(3-methylphenyl)phenyl]pentyl]-N-[1-(methylamino)propan-2-yl]piperidine-1-carboxamide.
| Compound Name | 3-[1-hydroxy-5-methoxy-1-[2-(3-methylphenyl)phenyl]pentyl]-N-[1-(methylamino)propan-2-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 67192406 |
| Molecular Formula | C29H43N3O3 |
| Molecular Weight | 481.68 g/mol |
| Exact Mass | 481.33 |
| IUPAC Name | 3-[1-hydroxy-5-methoxy-1-[2-(3-methylphenyl)phenyl]pentyl]-N-[1-(methylamino)propan-2-yl]piperidine-1-carboxamide |
| SMILES | CNCC(C)NC(=O)N1CCCC(C(O)(CCCCOC)c2ccccc2-c2cccc(C)c2)C1 |
| InChI | InChI=1S/C29H43N3O3/c1-22-11-9-12-24(19-22)26-14-5-6-15-27(26)29(34,16-7-8-18-35-4)25-13-10-17-32(21-25)28(33)31-23(2)20-30-3/h5-6,9,11-12,14-15,19,23,25,30,34H,7-8,10,13,16-18,20-21H2,1-4H3,(H,31,33) |
| InChIKey | VHQFKYJNROZJDC-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.68 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|