C27H38ClN3O3 — CID 70326651
(3R)-3-[(1S)-1-[2-(2-chlorophenyl)phenyl]-1,5-dihydroxypentyl]-N-[(2S)-1-(methylamino)propan-2-yl]piperidine-1-carboxamide (PubChem CID 70326651) has the molecular formula C27H38ClN3O3 and a molecular weight of 488.07 g/mol. Its IUPAC name is (3R)-3-[(1S)-1-[2-(2-chlorophenyl)phenyl]-1,5-dihydroxypentyl]-N-[(2S)-1-(methylamino)propan-2-yl]piperidine-1-carboxamide.
| Compound Name | (3R)-3-[(1S)-1-[2-(2-chlorophenyl)phenyl]-1,5-dihydroxypentyl]-N-[(2S)-1-(methylamino)propan-2-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 70326651 |
| Molecular Formula | C27H38ClN3O3 |
| Molecular Weight | 488.07 g/mol |
| Exact Mass | 487.26 |
| IUPAC Name | (3R)-3-[(1S)-1-[2-(2-chlorophenyl)phenyl]-1,5-dihydroxypentyl]-N-[(2S)-1-(methylamino)propan-2-yl]piperidine-1-carboxamide |
| SMILES | CNC[C@H](C)NC(=O)N1CCC[C@@H]([C@@](O)(CCCCO)c2ccccc2-c2ccccc2Cl)C1 |
| InChI | InChI=1S/C27H38ClN3O3/c1-20(18-29-2)30-26(33)31-16-9-10-21(19-31)27(34,15-7-8-17-32)24-13-5-3-11-22(24)23-12-4-6-14-25(23)28/h3-6,11-14,20-21,29,32,34H,7-10,15-19H2,1-2H3,(H,30,33)/t20-,21+,27-/m0/s1 |
| InChIKey | KLGCFXSOJBRBTJ-ISCCLHIJSA-N |
| XLogP | 4.39 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.07 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|