C21H13F3N4O2 — CID 67196351
2-phenyl-N-[4-pyrimidin-4-yl-3-(3,4,5-trifluorophenyl)-1,2-oxazol-5-yl]acetamide (PubChem CID 67196351) has the molecular formula C21H13F3N4O2 and a molecular weight of 410.36 g/mol. Its IUPAC name is 2-phenyl-N-[4-pyrimidin-4-yl-3-(3,4,5-trifluorophenyl)-1,2-oxazol-5-yl]acetamide.
| Compound Name | 2-phenyl-N-[4-pyrimidin-4-yl-3-(3,4,5-trifluorophenyl)-1,2-oxazol-5-yl]acetamide |
|---|---|
| PubChem CID | 67196351 |
| Molecular Formula | C21H13F3N4O2 |
| Molecular Weight | 410.36 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | 2-phenyl-N-[4-pyrimidin-4-yl-3-(3,4,5-trifluorophenyl)-1,2-oxazol-5-yl]acetamide |
| SMILES | O=C(Cc1ccccc1)Nc1onc(-c2cc(F)c(F)c(F)c2)c1-c1ccncn1 |
| InChI | InChI=1S/C21H13F3N4O2/c22-14-9-13(10-15(23)19(14)24)20-18(16-6-7-25-11-26-16)21(30-28-20)27-17(29)8-12-4-2-1-3-5-12/h1-7,9-11H,8H2,(H,27,29) |
| InChIKey | GYGKDFYDJKTKGP-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.36 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|