C21H14FN5O4 — CID 67197451
N-[3-(4-fluorophenyl)-4-pyrimidin-4-yl-1,2-oxazol-5-yl]-2-(4-nitrophenyl)acetamide (PubChem CID 67197451) has the molecular formula C21H14FN5O4 and a molecular weight of 419.37 g/mol. Its IUPAC name is N-[3-(4-fluorophenyl)-4-pyrimidin-4-yl-1,2-oxazol-5-yl]-2-(4-nitrophenyl)acetamide.
| Compound Name | N-[3-(4-fluorophenyl)-4-pyrimidin-4-yl-1,2-oxazol-5-yl]-2-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 67197451 |
| Molecular Formula | C21H14FN5O4 |
| Molecular Weight | 419.37 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | N-[3-(4-fluorophenyl)-4-pyrimidin-4-yl-1,2-oxazol-5-yl]-2-(4-nitrophenyl)acetamide |
| SMILES | O=C(Cc1ccc([N+](=O)[O-])cc1)Nc1onc(-c2ccc(F)cc2)c1-c1ccncn1 |
| InChI | InChI=1S/C21H14FN5O4/c22-15-5-3-14(4-6-15)20-19(17-9-10-23-12-24-17)21(31-26-20)25-18(28)11-13-1-7-16(8-2-13)27(29)30/h1-10,12H,11H2,(H,25,28) |
| InChIKey | ABYSAIRUEFPYNC-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 124.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.37 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|