C22H25F3N4O2 — CID 67196355
8-cyclohexyl-1-propyl-2-[[3-(trifluoromethyl)phenyl]methoxy]-7H-purin-6-one (PubChem CID 67196355) has the molecular formula C22H25F3N4O2 and a molecular weight of 434.46 g/mol. Its IUPAC name is 8-cyclohexyl-1-propyl-2-[[3-(trifluoromethyl)phenyl]methoxy]-7H-purin-6-one.
| Compound Name | 8-cyclohexyl-1-propyl-2-[[3-(trifluoromethyl)phenyl]methoxy]-7H-purin-6-one |
|---|---|
| PubChem CID | 67196355 |
| Molecular Formula | C22H25F3N4O2 |
| Molecular Weight | 434.46 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | 8-cyclohexyl-1-propyl-2-[[3-(trifluoromethyl)phenyl]methoxy]-7H-purin-6-one |
| SMILES | CCCn1c(OCc2cccc(C(F)(F)F)c2)nc2nc(C3CCCCC3)[nH]c2c1=O |
| InChI | InChI=1S/C22H25F3N4O2/c1-2-11-29-20(30)17-19(27-18(26-17)15-8-4-3-5-9-15)28-21(29)31-13-14-7-6-10-16(12-14)22(23,24)25/h6-7,10,12,15H,2-5,8-9,11,13H2,1H3,(H,26,27) |
| InChIKey | QWCWFYFDGQKFMY-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.46 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |