C13H10ClN3O — CID 67199437
7-chloro-6-pyridin-3-yl-3,4-dihydro-1H-quinoxalin-2-one (PubChem CID 67199437) has the molecular formula C13H10ClN3O and a molecular weight of 259.70 g/mol. Its IUPAC name is 7-chloro-6-pyridin-3-yl-3,4-dihydro-1H-quinoxalin-2-one.
| Compound Name | 7-chloro-6-pyridin-3-yl-3,4-dihydro-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 67199437 |
| Molecular Formula | C13H10ClN3O |
| Molecular Weight | 259.70 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 7-chloro-6-pyridin-3-yl-3,4-dihydro-1H-quinoxalin-2-one |
| SMILES | O=C1CNc2cc(-c3cccnc3)c(Cl)cc2N1 |
| InChI | InChI=1S/C13H10ClN3O/c14-10-5-12-11(16-7-13(18)17-12)4-9(10)8-2-1-3-15-6-8/h1-6,16H,7H2,(H,17,18) |
| InChIKey | KKGMZFOUBPWZIO-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.70 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |