C26H33N5O3 — CID 67199720
1-[4-[[3-(4-tert-butylphenyl)-5,5-dimethyl-2,4-dioxoimidazolidin-1-yl]methyl]-2-pyridinyl]-3-cyclobutylurea (PubChem CID 67199720) has the molecular formula C26H33N5O3 and a molecular weight of 463.58 g/mol. Its IUPAC name is 1-[4-[[3-(4-tert-butylphenyl)-5,5-dimethyl-2,4-dioxoimidazolidin-1-yl]methyl]-2-pyridinyl]-3-cyclobutylurea.
| Compound Name | 1-[4-[[3-(4-tert-butylphenyl)-5,5-dimethyl-2,4-dioxoimidazolidin-1-yl]methyl]-2-pyridinyl]-3-cyclobutylurea |
|---|---|
| PubChem CID | 67199720 |
| Molecular Formula | C26H33N5O3 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.26 |
| IUPAC Name | 1-[4-[[3-(4-tert-butylphenyl)-5,5-dimethyl-2,4-dioxoimidazolidin-1-yl]methyl]-2-pyridinyl]-3-cyclobutylurea |
| SMILES | CC(C)(C)c1ccc(N2C(=O)N(Cc3ccnc(NC(=O)NC4CCC4)c3)C(C)(C)C2=O)cc1 |
| InChI | InChI=1S/C26H33N5O3/c1-25(2,3)18-9-11-20(12-10-18)31-22(32)26(4,5)30(24(31)34)16-17-13-14-27-21(15-17)29-23(33)28-19-7-6-8-19/h9-15,19H,6-8,16H2,1-5H3,(H2,27,28,29,33) |
| InChIKey | JGWFJBMVTSGHPK-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|