About phenyl 3-butoxyprop-2-enoate
phenyl 3-butoxyprop-2-enoate (PubChem CID 67200074) has the molecular formula C13H16O3
and a molecular weight of 220.27 g/mol. Its IUPAC name is phenyl 3-butoxyprop-2-enoate.
Molecular Properties
| Compound Name | phenyl 3-butoxyprop-2-enoate |
| PubChem CID | 67200074 |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | phenyl 3-butoxyprop-2-enoate |
| SMILES | CCCCOC=CC(=O)Oc1ccccc1 |
| InChI | InChI=1S/C13H16O3/c1-2-3-10-15-11-9-13(14)16-12-7-5-4-6-8-12/h4-9,11H,2-3,10H2,1H3 |
| InChIKey | CFAPRMDLMQRRKL-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze phenyl 3-butoxyprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl 3-butoxyprop-2-enoate?
The IUPAC name of phenyl 3-butoxyprop-2-enoate (CID 67200074) is phenyl 3-butoxyprop-2-enoate.
What is the SMILES notation for phenyl 3-butoxyprop-2-enoate?
The canonical SMILES for phenyl 3-butoxyprop-2-enoate is CCCCOC=CC(=O)Oc1ccccc1.
What is the InChIKey of phenyl 3-butoxyprop-2-enoate?
The InChIKey is CFAPRMDLMQRRKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O3/c1-2-3-10-15-11-9-13(14)16-12-7-5-4-6-8-12/h4-9,11H,2-3,10H2,1H3.
What are the key properties of phenyl 3-butoxyprop-2-enoate?
phenyl 3-butoxyprop-2-enoate has a molecular weight of 220.27 g/mol, XLogP of 2.92, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl 3-butoxyprop-2-enoate is sourced from PubChem (CID 67200074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).