About 3-butoxyprop-2-enamide
3-butoxyprop-2-enamide (PubChem CID 54167422) has the molecular formula C7H13NO2
and a molecular weight of 143.19 g/mol. Its IUPAC name is 3-butoxyprop-2-enamide.
Molecular Properties
| Compound Name | 3-butoxyprop-2-enamide |
| PubChem CID | 54167422 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | 3-butoxyprop-2-enamide |
| SMILES | CCCCOC=CC(N)=O |
| InChI | InChI=1S/C7H13NO2/c1-2-3-5-10-6-4-7(8)9/h4,6H,2-3,5H2,1H3,(H2,8,9) |
| InChIKey | OSQHGJSWWLGBGS-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-butoxyprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butoxyprop-2-enamide?
The IUPAC name of 3-butoxyprop-2-enamide (CID 54167422) is 3-butoxyprop-2-enamide.
What is the SMILES notation for 3-butoxyprop-2-enamide?
The canonical SMILES for 3-butoxyprop-2-enamide is CCCCOC=CC(N)=O.
What is the InChIKey of 3-butoxyprop-2-enamide?
The InChIKey is OSQHGJSWWLGBGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2/c1-2-3-5-10-6-4-7(8)9/h4,6H,2-3,5H2,1H3,(H2,8,9).
What are the key properties of 3-butoxyprop-2-enamide?
3-butoxyprop-2-enamide has a molecular weight of 143.19 g/mol, XLogP of 0.80, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butoxyprop-2-enamide is sourced from PubChem (CID 54167422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).